C24H30ClNO4S — CID 10790279
4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-cyclohexylethyl]phenyl]butanoic acid (PubChem CID 10790279) has the molecular formula C24H30ClNO4S and a molecular weight of 464.03 g/mol. Its IUPAC name is 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-cyclohexylethyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-cyclohexylethyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 10790279 |
| Molecular Formula | C24H30ClNO4S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-cyclohexylethyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(CC2CCCCC2)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H30ClNO4S/c25-21-13-15-22(16-14-21)31(29,30)26-23(17-19-5-2-1-3-6-19)20-11-9-18(10-12-20)7-4-8-24(27)28/h9-16,19,23,26H,1-8,17H2,(H,27,28) |
| InChIKey | JIHQYRGYGTWART-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |