C26H27ClFNO4S — CID 23353815
methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-3-(4-fluorophenyl)propyl]phenyl]butanoate (PubChem CID 23353815) has the molecular formula C26H27ClFNO4S and a molecular weight of 504.02 g/mol. Its IUPAC name is methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-3-(4-fluorophenyl)propyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-3-(4-fluorophenyl)propyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23353815 |
| Molecular Formula | C26H27ClFNO4S |
| Molecular Weight | 504.02 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-3-(4-fluorophenyl)propyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCc2ccc(F)cc2)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H27ClFNO4S/c1-33-26(30)4-2-3-19-5-10-21(11-6-19)25(18-9-20-7-14-23(28)15-8-20)29-34(31,32)24-16-12-22(27)13-17-24/h5-8,10-17,25,29H,2-4,9,18H2,1H3 |
| InChIKey | YTIOYVXCLASJRP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.02 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |