C25H27NO4S — CID 23353880
methyl 4-[4-[1-(benzenesulfonamido)-2-phenylethyl]phenyl]butanoate (PubChem CID 23353880) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is methyl 4-[4-[1-(benzenesulfonamido)-2-phenylethyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[1-(benzenesulfonamido)-2-phenylethyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23353880 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | methyl 4-[4-[1-(benzenesulfonamido)-2-phenylethyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(Cc2ccccc2)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO4S/c1-30-25(27)14-8-11-20-15-17-22(18-16-20)24(19-21-9-4-2-5-10-21)26-31(28,29)23-12-6-3-7-13-23/h2-7,9-10,12-13,15-18,24,26H,8,11,14,19H2,1H3 |
| InChIKey | NQHHRGXESSUUMS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |