C25H34ClNO4S — CID 23353761
methyl 5-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-methylhexyl]phenyl]pentanoate (PubChem CID 23353761) has the molecular formula C25H34ClNO4S and a molecular weight of 480.07 g/mol. Its IUPAC name is methyl 5-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-methylhexyl]phenyl]pentanoate.
| Compound Name | methyl 5-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-methylhexyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 23353761 |
| Molecular Formula | C25H34ClNO4S |
| Molecular Weight | 480.07 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | methyl 5-[4-[1-[(4-chlorophenyl)sulfonylamino]-5-methylhexyl]phenyl]pentanoate |
| SMILES | COC(=O)CCCCc1ccc(C(CCCC(C)C)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H34ClNO4S/c1-19(2)7-6-9-24(27-32(29,30)23-17-15-22(26)16-18-23)21-13-11-20(12-14-21)8-4-5-10-25(28)31-3/h11-19,24,27H,4-10H2,1-3H3 |
| InChIKey | OQQXCOZBTBXFNS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.07 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|