C23H32ClNO4S2 — CID 139712838
methyl 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-methylheptyl]thiophen-2-yl]butanoate (PubChem CID 139712838) has the molecular formula C23H32ClNO4S2 and a molecular weight of 486.10 g/mol. Its IUPAC name is methyl 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-methylheptyl]thiophen-2-yl]butanoate.
| Compound Name | methyl 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-methylheptyl]thiophen-2-yl]butanoate |
|---|---|
| PubChem CID | 139712838 |
| Molecular Formula | C23H32ClNO4S2 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | methyl 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-methylheptyl]thiophen-2-yl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCCCC(C)C)NS(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C23H32ClNO4S2/c1-17(2)7-4-5-9-21(25-31(27,28)20-14-11-18(24)12-15-20)22-16-13-19(30-22)8-6-10-23(26)29-3/h11-17,21,25H,4-10H2,1-3H3 |
| InChIKey | AMESPRWGDHWVRY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|