C23H27F4NO4S — CID 67579712
methyl 4-[4-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoate (PubChem CID 67579712) has the molecular formula C23H27F4NO4S and a molecular weight of 489.53 g/mol. Its IUPAC name is methyl 4-[4-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoate |
|---|---|
| PubChem CID | 67579712 |
| Molecular Formula | C23H27F4NO4S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl 4-[4-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCCCC(F)(F)F)NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H27F4NO4S/c1-32-22(29)7-4-5-17-8-10-18(11-9-17)21(6-2-3-16-23(25,26)27)28-33(30,31)20-14-12-19(24)13-15-20/h8-15,21,28H,2-7,16H2,1H3 |
| InChIKey | WJVRWKKYSAXNMB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|