C21H26FNO5S — CID 139616866
methyl 7-(4-fluorophenyl)-7-[(4-methoxyphenyl)sulfonylamino]heptanoate (PubChem CID 139616866) has the molecular formula C21H26FNO5S and a molecular weight of 423.51 g/mol. Its IUPAC name is methyl 7-(4-fluorophenyl)-7-[(4-methoxyphenyl)sulfonylamino]heptanoate.
| Compound Name | methyl 7-(4-fluorophenyl)-7-[(4-methoxyphenyl)sulfonylamino]heptanoate |
|---|---|
| PubChem CID | 139616866 |
| Molecular Formula | C21H26FNO5S |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 7-(4-fluorophenyl)-7-[(4-methoxyphenyl)sulfonylamino]heptanoate |
| SMILES | COC(=O)CCCCCC(NS(=O)(=O)c1ccc(OC)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FNO5S/c1-27-18-12-14-19(15-13-18)29(25,26)23-20(16-8-10-17(22)11-9-16)6-4-3-5-7-21(24)28-2/h8-15,20,23H,3-7H2,1-2H3 |
| InChIKey | YBOHQOCMHSNZMK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|