C23H31NO4S — CID 139616897
methyl 9-[(3-methylphenyl)sulfonylamino]-9-phenylnonanoate (PubChem CID 139616897) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is methyl 9-[(3-methylphenyl)sulfonylamino]-9-phenylnonanoate.
| Compound Name | methyl 9-[(3-methylphenyl)sulfonylamino]-9-phenylnonanoate |
|---|---|
| PubChem CID | 139616897 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | methyl 9-[(3-methylphenyl)sulfonylamino]-9-phenylnonanoate |
| SMILES | COC(=O)CCCCCCCC(NS(=O)(=O)c1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO4S/c1-19-12-11-15-21(18-19)29(26,27)24-22(20-13-7-6-8-14-20)16-9-4-3-5-10-17-23(25)28-2/h6-8,11-15,18,22,24H,3-5,9-10,16-17H2,1-2H3 |
| InChIKey | RKBWLCJTDHCYNG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|