C22H25F4NO4S — CID 139616929
methyl 8-(4-fluorophenyl)-8-[[3-(trifluoromethyl)phenyl]sulfonylamino]octanoate (PubChem CID 139616929) has the molecular formula C22H25F4NO4S and a molecular weight of 475.50 g/mol. Its IUPAC name is methyl 8-(4-fluorophenyl)-8-[[3-(trifluoromethyl)phenyl]sulfonylamino]octanoate.
| Compound Name | methyl 8-(4-fluorophenyl)-8-[[3-(trifluoromethyl)phenyl]sulfonylamino]octanoate |
|---|---|
| PubChem CID | 139616929 |
| Molecular Formula | C22H25F4NO4S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | methyl 8-(4-fluorophenyl)-8-[[3-(trifluoromethyl)phenyl]sulfonylamino]octanoate |
| SMILES | COC(=O)CCCCCCC(NS(=O)(=O)c1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25F4NO4S/c1-31-21(28)10-5-3-2-4-9-20(16-11-13-18(23)14-12-16)27-32(29,30)19-8-6-7-17(15-19)22(24,25)26/h6-8,11-15,20,27H,2-5,9-10H2,1H3 |
| InChIKey | JPICYVFJNQXQFI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|