C22H29NO4S — CID 139616772
methyl 8-[(2-methylphenyl)sulfonylamino]-8-phenyloctanoate (PubChem CID 139616772) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is methyl 8-[(2-methylphenyl)sulfonylamino]-8-phenyloctanoate.
| Compound Name | methyl 8-[(2-methylphenyl)sulfonylamino]-8-phenyloctanoate |
|---|---|
| PubChem CID | 139616772 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl 8-[(2-methylphenyl)sulfonylamino]-8-phenyloctanoate |
| SMILES | COC(=O)CCCCCCC(NS(=O)(=O)c1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C22H29NO4S/c1-18-12-10-11-16-21(18)28(25,26)23-20(19-13-6-5-7-14-19)15-8-3-4-9-17-22(24)27-2/h5-7,10-14,16,20,23H,3-4,8-9,15,17H2,1-2H3 |
| InChIKey | BPUSGSAMVFBDCM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|