C22H28FNO4S — CID 139616966
methyl 9-[(4-fluorophenyl)sulfonylamino]-9-phenylnonanoate (PubChem CID 139616966) has the molecular formula C22H28FNO4S and a molecular weight of 421.53 g/mol. Its IUPAC name is methyl 9-[(4-fluorophenyl)sulfonylamino]-9-phenylnonanoate.
| Compound Name | methyl 9-[(4-fluorophenyl)sulfonylamino]-9-phenylnonanoate |
|---|---|
| PubChem CID | 139616966 |
| Molecular Formula | C22H28FNO4S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | methyl 9-[(4-fluorophenyl)sulfonylamino]-9-phenylnonanoate |
| SMILES | COC(=O)CCCCCCCC(NS(=O)(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H28FNO4S/c1-28-22(25)13-9-4-2-3-8-12-21(18-10-6-5-7-11-18)24-29(26,27)20-16-14-19(23)15-17-20/h5-7,10-11,14-17,21,24H,2-4,8-9,12-13H2,1H3 |
| InChIKey | ROAZPZIDANQDLV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|