C23H29ClFNO4S — CID 67579791
methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]phenyl]butanoate (PubChem CID 67579791) has the molecular formula C23H29ClFNO4S and a molecular weight of 470.01 g/mol. Its IUPAC name is methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]phenyl]butanoate |
|---|---|
| PubChem CID | 67579791 |
| Molecular Formula | C23H29ClFNO4S |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | methyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCCCCF)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H29ClFNO4S/c1-30-23(27)8-5-6-18-9-11-19(12-10-18)22(7-3-2-4-17-25)26-31(28,29)21-15-13-20(24)14-16-21/h9-16,22,26H,2-8,17H2,1H3 |
| InChIKey | PCFWSXVYFVNQFE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|