C28H32ClNO4S — CID 23353783
4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-phenylhexyl]phenyl]butanoic acid (PubChem CID 23353783) has the molecular formula C28H32ClNO4S and a molecular weight of 514.09 g/mol. Its IUPAC name is 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-phenylhexyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-phenylhexyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 23353783 |
| Molecular Formula | C28H32ClNO4S |
| Molecular Weight | 514.09 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-6-phenylhexyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(CCCCCc2ccccc2)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H32ClNO4S/c29-25-18-20-26(21-19-25)35(33,34)30-27(12-6-2-5-10-22-8-3-1-4-9-22)24-16-14-23(15-17-24)11-7-13-28(31)32/h1,3-4,8-9,14-21,27,30H,2,5-7,10-13H2,(H,31,32) |
| InChIKey | SNUFZJPFKQIBNX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.09 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|