C20H25ClFNO4S2 — CID 67579336
4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]thiophen-2-yl]butanoic acid (PubChem CID 67579336) has the molecular formula C20H25ClFNO4S2 and a molecular weight of 462.01 g/mol. Its IUPAC name is 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]thiophen-2-yl]butanoic acid.
| Compound Name | 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 67579336 |
| Molecular Formula | C20H25ClFNO4S2 |
| Molecular Weight | 462.01 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 4-[5-[1-[(4-chlorophenyl)sulfonylamino]-6-fluorohexyl]thiophen-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(CCCCCF)NS(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C20H25ClFNO4S2/c21-15-8-11-17(12-9-15)29(26,27)23-18(6-2-1-3-14-22)19-13-10-16(28-19)5-4-7-20(24)25/h8-13,18,23H,1-7,14H2,(H,24,25) |
| InChIKey | GWVVBDNWTSSNBJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.01 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|