C14H21FO3S — CID 141001212
4-[5-(6-fluoro-1-hydroxyhexyl)thiophen-2-yl]butanoic acid (PubChem CID 141001212) has the molecular formula C14H21FO3S and a molecular weight of 288.38 g/mol. Its IUPAC name is 4-[5-(6-fluoro-1-hydroxyhexyl)thiophen-2-yl]butanoic acid.
| Compound Name | 4-[5-(6-fluoro-1-hydroxyhexyl)thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 141001212 |
| Molecular Formula | C14H21FO3S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-[5-(6-fluoro-1-hydroxyhexyl)thiophen-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(O)CCCCCF)s1 |
| InChI | InChI=1S/C14H21FO3S/c15-10-3-1-2-6-12(16)13-9-8-11(19-13)5-4-7-14(17)18/h8-9,12,16H,1-7,10H2,(H,17,18) |
| InChIKey | VYRXDSVCFNEDGE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|