C17H21NO5S2 — CID 57319413
4-[5-[2-(benzylsulfonylamino)ethyl]thiophen-2-yl]-4-hydroxybutanoic acid (PubChem CID 57319413) has the molecular formula C17H21NO5S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-[5-[2-(benzylsulfonylamino)ethyl]thiophen-2-yl]-4-hydroxybutanoic acid.
| Compound Name | 4-[5-[2-(benzylsulfonylamino)ethyl]thiophen-2-yl]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 57319413 |
| Molecular Formula | C17H21NO5S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-[5-[2-(benzylsulfonylamino)ethyl]thiophen-2-yl]-4-hydroxybutanoic acid |
| SMILES | O=C(O)CCC(O)c1ccc(CCNS(=O)(=O)Cc2ccccc2)s1 |
| InChI | InChI=1S/C17H21NO5S2/c19-15(7-9-17(20)21)16-8-6-14(24-16)10-11-18-25(22,23)12-13-4-2-1-3-5-13/h1-6,8,15,18-19H,7,9-12H2,(H,20,21) |
| InChIKey | HDUSLDCBSXBKHR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |