C10H14ClNO4S2 — CID 106033208
4-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]butanoic acid (PubChem CID 106033208) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 4-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]butanoic acid.
| Compound Name | 4-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 106033208 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-[2-(5-chlorothiophen-2-yl)ethylsulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClNO4S2/c11-9-4-3-8(17-9)5-6-12-18(15,16)7-1-2-10(13)14/h3-4,12H,1-2,5-7H2,(H,13,14) |
| InChIKey | VDXASIHMJTXBCP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |