C12H17ClN2O3S — CID 122013691
3-[4-(5-chlorothiophen-2-yl)butylcarbamoylamino]propanoic acid (PubChem CID 122013691) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-[4-(5-chlorothiophen-2-yl)butylcarbamoylamino]propanoic acid.
| Compound Name | 3-[4-(5-chlorothiophen-2-yl)butylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122013691 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[4-(5-chlorothiophen-2-yl)butylcarbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCCCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H17ClN2O3S/c13-10-5-4-9(19-10)3-1-2-7-14-12(18)15-8-6-11(16)17/h4-5H,1-3,6-8H2,(H,16,17)(H2,14,15,18) |
| InChIKey | CRKZHALDUPNCTR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|