C19H24FNO4S2 — CID 139712800
4-[5-[1-[(4-fluorophenyl)sulfonylamino]pentyl]thiophen-2-yl]butanoic acid (PubChem CID 139712800) has the molecular formula C19H24FNO4S2 and a molecular weight of 413.54 g/mol. Its IUPAC name is 4-[5-[1-[(4-fluorophenyl)sulfonylamino]pentyl]thiophen-2-yl]butanoic acid.
| Compound Name | 4-[5-[1-[(4-fluorophenyl)sulfonylamino]pentyl]thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 139712800 |
| Molecular Formula | C19H24FNO4S2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-[5-[1-[(4-fluorophenyl)sulfonylamino]pentyl]thiophen-2-yl]butanoic acid |
| SMILES | CCCCC(NS(=O)(=O)c1ccc(F)cc1)c1ccc(CCCC(=O)O)s1 |
| InChI | InChI=1S/C19H24FNO4S2/c1-2-3-6-17(18-13-10-15(26-18)5-4-7-19(22)23)21-27(24,25)16-11-8-14(20)9-12-16/h8-13,17,21H,2-7H2,1H3,(H,22,23) |
| InChIKey | XQJUWNNIQQXBMP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |