C14H21FN2O3S — CID 40612538
(2S)-2-[(4-fluorophenyl)sulfonylamino]-N-[(2R)-pentan-2-yl]propanamide (PubChem CID 40612538) has the molecular formula C14H21FN2O3S and a molecular weight of 316.40 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)sulfonylamino]-N-[(2R)-pentan-2-yl]propanamide.
| Compound Name | (2S)-2-[(4-fluorophenyl)sulfonylamino]-N-[(2R)-pentan-2-yl]propanamide |
|---|---|
| PubChem CID | 40612538 |
| Molecular Formula | C14H21FN2O3S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)sulfonylamino]-N-[(2R)-pentan-2-yl]propanamide |
| SMILES | CCC[C@@H](C)NC(=O)[C@H](C)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O3S/c1-4-5-10(2)16-14(18)11(3)17-21(19,20)13-8-6-12(15)7-9-13/h6-11,17H,4-5H2,1-3H3,(H,16,18)/t10-,11+/m1/s1 |
| InChIKey | YBKMWJGWWQEDGR-MNOVXSKESA-N |
| XLogP | 1.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |