C11H13FNO4S- — CID 4282675
2-[(4-fluorophenyl)sulfonylamino]pentanoate (PubChem CID 4282675) has the molecular formula C11H13FNO4S- and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]pentanoate.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 4282675 |
| Molecular Formula | C11H13FNO4S- |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]pentanoate |
| SMILES | CCCC(NS(=O)(=O)c1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H14FNO4S/c1-2-3-10(11(14)15)13-18(16,17)9-6-4-8(12)5-7-9/h4-7,10,13H,2-3H2,1H3,(H,14,15)/p-1 |
| InChIKey | WIJBWJWHBZDCAI-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |