C26H28ClNO4S — CID 23353743
ethyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]phenyl]butanoate (PubChem CID 23353743) has the molecular formula C26H28ClNO4S and a molecular weight of 486.03 g/mol. Its IUPAC name is ethyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]phenyl]butanoate.
| Compound Name | ethyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23353743 |
| Molecular Formula | C26H28ClNO4S |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | ethyl 4-[4-[1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(C(Cc2ccccc2)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H28ClNO4S/c1-2-32-26(29)10-6-9-20-11-13-22(14-12-20)25(19-21-7-4-3-5-8-21)28-33(30,31)24-17-15-23(27)16-18-24/h3-5,7-8,11-18,25,28H,2,6,9-10,19H2,1H3 |
| InChIKey | UXJDXXZOLOPYCM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |