C24H25ClFNO2S — CID 57071853
N-[1-(4-butylphenyl)-2-(2-fluorophenyl)ethyl]-4-chlorobenzenesulfonamide (PubChem CID 57071853) has the molecular formula C24H25ClFNO2S and a molecular weight of 445.99 g/mol. Its IUPAC name is N-[1-(4-butylphenyl)-2-(2-fluorophenyl)ethyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[1-(4-butylphenyl)-2-(2-fluorophenyl)ethyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 57071853 |
| Molecular Formula | C24H25ClFNO2S |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[1-(4-butylphenyl)-2-(2-fluorophenyl)ethyl]-4-chlorobenzenesulfonamide |
| SMILES | CCCCc1ccc(C(Cc2ccccc2F)NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H25ClFNO2S/c1-2-3-6-18-9-11-19(12-10-18)24(17-20-7-4-5-8-23(20)26)27-30(28,29)22-15-13-21(25)14-16-22/h4-5,7-16,24,27H,2-3,6,17H2,1H3 |
| InChIKey | VQHTWKFRUWZEIQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |