C17H22ClNO2S2 — CID 10248669
4-chloro-N-(5-methyl-1-thiophen-2-ylhexyl)benzenesulfonamide (PubChem CID 10248669) has the molecular formula C17H22ClNO2S2 and a molecular weight of 371.96 g/mol. Its IUPAC name is 4-chloro-N-(5-methyl-1-thiophen-2-ylhexyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-methyl-1-thiophen-2-ylhexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 10248669 |
| Molecular Formula | C17H22ClNO2S2 |
| Molecular Weight | 371.96 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-chloro-N-(5-methyl-1-thiophen-2-ylhexyl)benzenesulfonamide |
| SMILES | CC(C)CCCC(NS(=O)(=O)c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C17H22ClNO2S2/c1-13(2)5-3-6-16(17-7-4-12-22-17)19-23(20,21)15-10-8-14(18)9-11-15/h4,7-13,16,19H,3,5-6H2,1-2H3 |
| InChIKey | BJCCXFANKSYYCV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |