C13H16ClN3O2S2 — CID 64600123
6-amino-5-chloro-N-(1-thiophen-2-ylbutyl)pyridine-3-sulfonamide (PubChem CID 64600123) has the molecular formula C13H16ClN3O2S2 and a molecular weight of 345.88 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(1-thiophen-2-ylbutyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(1-thiophen-2-ylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64600123 |
| Molecular Formula | C13H16ClN3O2S2 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 6-amino-5-chloro-N-(1-thiophen-2-ylbutyl)pyridine-3-sulfonamide |
| SMILES | CCCC(NS(=O)(=O)c1cnc(N)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C13H16ClN3O2S2/c1-2-4-11(12-5-3-6-20-12)17-21(18,19)9-7-10(14)13(15)16-8-9/h3,5-8,11,17H,2,4H2,1H3,(H2,15,16) |
| InChIKey | VRWMRAVLULYGOA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |