C14H14Cl2N2OS — CID 61381170
5,6-dichloro-N-(1-thiophen-2-ylbutyl)pyridine-3-carboxamide (PubChem CID 61381170) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is 5,6-dichloro-N-(1-thiophen-2-ylbutyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(1-thiophen-2-ylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61381170 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 5,6-dichloro-N-(1-thiophen-2-ylbutyl)pyridine-3-carboxamide |
| SMILES | CCCC(NC(=O)c1cnc(Cl)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-2-4-11(12-5-3-6-20-12)18-14(19)9-7-10(15)13(16)17-8-9/h3,5-8,11H,2,4H2,1H3,(H,18,19) |
| InChIKey | HVSRQRGBCBJRFC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|