C16H16Cl2N2O — CID 7987043
5,6-dichloro-N-[(2S)-4-phenylbutan-2-yl]pyridine-3-carboxamide (PubChem CID 7987043) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 5,6-dichloro-N-[(2S)-4-phenylbutan-2-yl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(2S)-4-phenylbutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 7987043 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5,6-dichloro-N-[(2S)-4-phenylbutan-2-yl]pyridine-3-carboxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O/c1-11(7-8-12-5-3-2-4-6-12)20-16(21)13-9-14(17)15(18)19-10-13/h2-6,9-11H,7-8H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | JWEGIWPDAKYNAQ-NSHDSACASA-N |
| XLogP | 4.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|