C17H16ClF2NO — CID 3527786
2-chloro-4,5-difluoro-N-(4-phenylbutan-2-yl)benzamide (PubChem CID 3527786) has the molecular formula C17H16ClF2NO and a molecular weight of 323.77 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(4-phenylbutan-2-yl)benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-(4-phenylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 3527786 |
| Molecular Formula | C17H16ClF2NO |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(4-phenylbutan-2-yl)benzamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H16ClF2NO/c1-11(7-8-12-5-3-2-4-6-12)21-17(22)13-9-15(19)16(20)10-14(13)18/h2-6,9-11H,7-8H2,1H3,(H,21,22) |
| InChIKey | TUULCBKLXIJTJL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|