C15H12ClF2NO3 — CID 122148768
2-chloro-4,5-difluoro-N-[4-(furan-2-yl)-4-oxobutan-2-yl]benzamide (PubChem CID 122148768) has the molecular formula C15H12ClF2NO3 and a molecular weight of 327.71 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-(furan-2-yl)-4-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-(furan-2-yl)-4-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 122148768 |
| Molecular Formula | C15H12ClF2NO3 |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-(furan-2-yl)-4-oxobutan-2-yl]benzamide |
| SMILES | CC(CC(=O)c1ccco1)NC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H12ClF2NO3/c1-8(5-13(20)14-3-2-4-22-14)19-15(21)9-6-11(17)12(18)7-10(9)16/h2-4,6-8H,5H2,1H3,(H,19,21) |
| InChIKey | NPLIMHPFCQCQCN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|