C13H12BrNO4 — CID 124591402
3-bromo-N-[(2S)-4-(furan-2-yl)-4-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 124591402) has the molecular formula C13H12BrNO4 and a molecular weight of 326.15 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-4-(furan-2-yl)-4-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | 3-bromo-N-[(2S)-4-(furan-2-yl)-4-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124591402 |
| Molecular Formula | C13H12BrNO4 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 3-bromo-N-[(2S)-4-(furan-2-yl)-4-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | C[C@@H](CC(=O)c1ccco1)NC(=O)c1occc1Br |
| InChI | InChI=1S/C13H12BrNO4/c1-8(7-10(16)11-3-2-5-18-11)15-13(17)12-9(14)4-6-19-12/h2-6,8H,7H2,1H3,(H,15,17)/t8-/m0/s1 |
| InChIKey | ICVBVRIKLZTOKK-QMMMGPOBSA-N |
| XLogP | 3.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |