C9H10Cl2N2O2 — CID 79027668
5,6-dichloro-N-[(2R)-1-hydroxypropan-2-yl]pyridine-3-carboxamide (PubChem CID 79027668) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 5,6-dichloro-N-[(2R)-1-hydroxypropan-2-yl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(2R)-1-hydroxypropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79027668 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 5,6-dichloro-N-[(2R)-1-hydroxypropan-2-yl]pyridine-3-carboxamide |
| SMILES | C[C@H](CO)NC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-5(4-14)13-9(15)6-2-7(10)8(11)12-3-6/h2-3,5,14H,4H2,1H3,(H,13,15)/t5-/m1/s1 |
| InChIKey | UQDSSJNRYJIEML-RXMQYKEDSA-N |
| XLogP | 1.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|