C18H20Cl2N2O — CID 7999529
5,6-dichloro-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]pyridine-3-carboxamide (PubChem CID 7999529) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is 5,6-dichloro-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 7999529 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5,6-dichloro-N-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]pyridine-3-carboxamide |
| SMILES | CC(C)Cc1ccc([C@@H](C)NC(=O)c2cnc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-11(2)8-13-4-6-14(7-5-13)12(3)22-18(23)15-9-16(19)17(20)21-10-15/h4-7,9-12H,8H2,1-3H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | ZRKIWEVRUVFYFZ-GFCCVEGCSA-N |
| XLogP | 5.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|