C21H27NO — CID 8018859
3,5-dimethyl-N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide (PubChem CID 8018859) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 8018859 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3,5-dimethyl-N-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)N[C@@H](C)c2ccc(CC(C)C)cc2)c1 |
| InChI | InChI=1S/C21H27NO/c1-14(2)10-18-6-8-19(9-7-18)17(5)22-21(23)20-12-15(3)11-16(4)13-20/h6-9,11-14,17H,10H2,1-5H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | CNIGPINQPIBSQP-KRWDZBQOSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |