C16H21N3OS — CID 105069176
3-(ethylamino)-N-(1-thiophen-2-ylbutyl)pyridine-4-carboxamide (PubChem CID 105069176) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-(ethylamino)-N-(1-thiophen-2-ylbutyl)pyridine-4-carboxamide.
| Compound Name | 3-(ethylamino)-N-(1-thiophen-2-ylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105069176 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-(ethylamino)-N-(1-thiophen-2-ylbutyl)pyridine-4-carboxamide |
| SMILES | CCCC(NC(=O)c1ccncc1NCC)c1cccs1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-6-13(15-7-5-10-21-15)19-16(20)12-8-9-17-11-14(12)18-4-2/h5,7-11,13,18H,3-4,6H2,1-2H3,(H,19,20) |
| InChIKey | QDZQGXNJJCEELH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |