C17H20N2O3S — CID 95143397
2-[2-[[(1R)-1-thiophen-2-ylbutyl]carbamoyl]anilino]acetic acid (PubChem CID 95143397) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[2-[[(1R)-1-thiophen-2-ylbutyl]carbamoyl]anilino]acetic acid.
| Compound Name | 2-[2-[[(1R)-1-thiophen-2-ylbutyl]carbamoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 95143397 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[2-[[(1R)-1-thiophen-2-ylbutyl]carbamoyl]anilino]acetic acid |
| SMILES | CCC[C@@H](NC(=O)c1ccccc1NCC(=O)O)c1cccs1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-6-14(15-9-5-10-23-15)19-17(22)12-7-3-4-8-13(12)18-11-16(20)21/h3-5,7-10,14,18H,2,6,11H2,1H3,(H,19,22)(H,20,21)/t14-/m1/s1 |
| InChIKey | SLGMJYHRRQXIJA-CQSZACIVSA-N |
| XLogP | 3.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |