C14H12INO3S — CID 45350832
3-[(2-iodobenzoyl)amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 45350832) has the molecular formula C14H12INO3S and a molecular weight of 401.23 g/mol. Its IUPAC name is 3-[(2-iodobenzoyl)amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(2-iodobenzoyl)amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 45350832 |
| Molecular Formula | C14H12INO3S |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 3-[(2-iodobenzoyl)amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccccc1I)c1cccs1 |
| InChI | InChI=1S/C14H12INO3S/c15-10-5-2-1-4-9(10)14(19)16-11(8-13(17)18)12-6-3-7-20-12/h1-7,11H,8H2,(H,16,19)(H,17,18) |
| InChIKey | LSUCTIWHFKEWRX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|