C12H10INO3S2 — CID 79693778
3-[(5-iodothiophene-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 79693778) has the molecular formula C12H10INO3S2 and a molecular weight of 407.25 g/mol. Its IUPAC name is 3-[(5-iodothiophene-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(5-iodothiophene-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 79693778 |
| Molecular Formula | C12H10INO3S2 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | 3-[(5-iodothiophene-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1csc(I)c1)c1cccs1 |
| InChI | InChI=1S/C12H10INO3S2/c13-10-4-7(6-19-10)12(17)14-8(5-11(15)16)9-2-1-3-18-9/h1-4,6,8H,5H2,(H,14,17)(H,15,16) |
| InChIKey | HFOWJLQDZOYJTB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|