C16H17NO5S — CID 45350859
3-[(2,4-dimethoxybenzoyl)amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 45350859) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-[(2,4-dimethoxybenzoyl)amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(2,4-dimethoxybenzoyl)amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 45350859 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-[(2,4-dimethoxybenzoyl)amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | COc1ccc(C(=O)NC(CC(=O)O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C16H17NO5S/c1-21-10-5-6-11(13(8-10)22-2)16(20)17-12(9-15(18)19)14-4-3-7-23-14/h3-8,12H,9H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | TWCHOWSNEZHEGV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |