C13H10Cl2N2O3S — CID 106993309
3-[(2,6-dichloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 106993309) has the molecular formula C13H10Cl2N2O3S and a molecular weight of 345.21 g/mol. Its IUPAC name is 3-[(2,6-dichloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(2,6-dichloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 106993309 |
| Molecular Formula | C13H10Cl2N2O3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 3-[(2,6-dichloropyridine-3-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(Cl)nc1Cl)c1cccs1 |
| InChI | InChI=1S/C13H10Cl2N2O3S/c14-10-4-3-7(12(15)17-10)13(20)16-8(6-11(18)19)9-2-1-5-21-9/h1-5,8H,6H2,(H,16,20)(H,18,19) |
| InChIKey | NTPLCUHUFGCULB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|