C10H13F2NOS — CID 103515707
2,2-difluoro-N-(1-thiophen-2-ylbutyl)acetamide (PubChem CID 103515707) has the molecular formula C10H13F2NOS and a molecular weight of 233.28 g/mol. Its IUPAC name is 2,2-difluoro-N-(1-thiophen-2-ylbutyl)acetamide.
| Compound Name | 2,2-difluoro-N-(1-thiophen-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 103515707 |
| Molecular Formula | C10H13F2NOS |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2,2-difluoro-N-(1-thiophen-2-ylbutyl)acetamide |
| SMILES | CCCC(NC(=O)C(F)F)c1cccs1 |
| InChI | InChI=1S/C10H13F2NOS/c1-2-4-7(8-5-3-6-15-8)13-10(14)9(11)12/h3,5-7,9H,2,4H2,1H3,(H,13,14) |
| InChIKey | BFXXLPPFNYJEGA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |