C13H22N2OS — CID 65229248
2-(aminomethyl)-N-(1-thiophen-2-ylbutyl)butanamide (PubChem CID 65229248) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(1-thiophen-2-ylbutyl)butanamide.
| Compound Name | 2-(aminomethyl)-N-(1-thiophen-2-ylbutyl)butanamide |
|---|---|
| PubChem CID | 65229248 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-(aminomethyl)-N-(1-thiophen-2-ylbutyl)butanamide |
| SMILES | CCCC(NC(=O)C(CC)CN)c1cccs1 |
| InChI | InChI=1S/C13H22N2OS/c1-3-6-11(12-7-5-8-17-12)15-13(16)10(4-2)9-14/h5,7-8,10-11H,3-4,6,9,14H2,1-2H3,(H,15,16) |
| InChIKey | JHWVXWGYVWIBJB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |