C30H42ClNO4S — CID 23353773
methyl 4-[4-[[(4-chlorophenyl)sulfonylamino]-(4-hexylcyclohexyl)methyl]phenyl]butanoate (PubChem CID 23353773) has the molecular formula C30H42ClNO4S and a molecular weight of 548.19 g/mol. Its IUPAC name is methyl 4-[4-[[(4-chlorophenyl)sulfonylamino]-(4-hexylcyclohexyl)methyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[[(4-chlorophenyl)sulfonylamino]-(4-hexylcyclohexyl)methyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23353773 |
| Molecular Formula | C30H42ClNO4S |
| Molecular Weight | 548.19 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | methyl 4-[4-[[(4-chlorophenyl)sulfonylamino]-(4-hexylcyclohexyl)methyl]phenyl]butanoate |
| SMILES | CCCCCCC1CCC(C(NS(=O)(=O)c2ccc(Cl)cc2)c2ccc(CCCC(=O)OC)cc2)CC1 |
| InChI | InChI=1S/C30H42ClNO4S/c1-3-4-5-6-8-23-11-15-25(16-12-23)30(32-37(34,35)28-21-19-27(31)20-22-28)26-17-13-24(14-18-26)9-7-10-29(33)36-2/h13-14,17-23,25,30,32H,3-12,15-16H2,1-2H3 |
| InChIKey | BQTMVEJOIORTBH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.19 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|