C21H19NO4S — CID 67841348
2-[4-[benzenesulfonamido(phenyl)methyl]phenyl]acetic acid (PubChem CID 67841348) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[4-[benzenesulfonamido(phenyl)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[benzenesulfonamido(phenyl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 67841348 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[4-[benzenesulfonamido(phenyl)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C(NS(=O)(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO4S/c23-20(24)15-16-11-13-18(14-12-16)21(17-7-3-1-4-8-17)22-27(25,26)19-9-5-2-6-10-19/h1-14,21-22H,15H2,(H,23,24) |
| InChIKey | JNYZGOSMNWXAFN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |