C14H15NO4S2 — CID 81389151
2-[4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]phenyl]acetic acid (PubChem CID 81389151) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 81389151 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-[4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]phenyl]acetic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(CC(=O)O)cc1)c1cccs1 |
| InChI | InChI=1S/C14H15NO4S2/c1-10(13-3-2-8-20-13)15-21(18,19)12-6-4-11(5-7-12)9-14(16)17/h2-8,10,15H,9H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | IRVJSIGFHKHAMU-SNVBAGLBSA-N |
| XLogP | 2.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |