C11H11NO4S3 — CID 81399028
4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 81399028) has the molecular formula C11H11NO4S3 and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 81399028 |
| Molecular Formula | C11H11NO4S3 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-[[(1R)-1-thiophen-2-ylethyl]sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1csc(C(=O)O)c1)c1cccs1 |
| InChI | InChI=1S/C11H11NO4S3/c1-7(9-3-2-4-17-9)12-19(15,16)8-5-10(11(13)14)18-6-8/h2-7,12H,1H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | LHSZIHHJNXOIFJ-SSDOTTSWSA-N |
| XLogP | 2.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |