C5H6N2O4S2 — CID 12704290
4-(hydrazinesulfonyl)thiophene-2-carboxylic acid (PubChem CID 12704290) has the molecular formula C5H6N2O4S2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-(hydrazinesulfonyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(hydrazinesulfonyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 12704290 |
| Molecular Formula | C5H6N2O4S2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 4-(hydrazinesulfonyl)thiophene-2-carboxylic acid |
| SMILES | NNS(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C5H6N2O4S2/c6-7-13(10,11)3-1-4(5(8)9)12-2-3/h1-2,7H,6H2,(H,8,9) |
| InChIKey | SPLXZXIXPYSDAW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|