C8H11NO5S3 — CID 104654649
4-(2-methylsulfinylethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 104654649) has the molecular formula C8H11NO5S3 and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-(2-methylsulfinylethylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 4-(2-methylsulfinylethylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 104654649 |
| Molecular Formula | C8H11NO5S3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 4-(2-methylsulfinylethylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | CS(=O)CCNS(=O)(=O)c1csc(C(=O)O)c1 |
| InChI | InChI=1S/C8H11NO5S3/c1-16(12)3-2-9-17(13,14)6-4-7(8(10)11)15-5-6/h4-5,9H,2-3H2,1H3,(H,10,11) |
| InChIKey | FQJPWYIEFUHMEV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |