C11H11NO4S3 — CID 61072744
4-[(5-methylthiophen-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61072744) has the molecular formula C11H11NO4S3 and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[(5-methylthiophen-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-methylthiophen-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61072744 |
| Molecular Formula | C11H11NO4S3 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 4-[(5-methylthiophen-2-yl)methylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(CNS(=O)(=O)c2csc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C11H11NO4S3/c1-7-2-3-8(18-7)5-12-19(15,16)9-4-10(11(13)14)17-6-9/h2-4,6,12H,5H2,1H3,(H,13,14) |
| InChIKey | SQWZBYXUKKBYIV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |