C15H17NO5S2 — CID 138032189
4-[2-(3-methoxy-5-methylphenyl)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 138032189) has the molecular formula C15H17NO5S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-[2-(3-methoxy-5-methylphenyl)ethylsulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-(3-methoxy-5-methylphenyl)ethylsulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 138032189 |
| Molecular Formula | C15H17NO5S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-[2-(3-methoxy-5-methylphenyl)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | COc1cc(C)cc(CCNS(=O)(=O)c2csc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C15H17NO5S2/c1-10-5-11(7-12(6-10)21-2)3-4-16-23(19,20)13-8-14(15(17)18)22-9-13/h5-9,16H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | IAVDKSLFMFPVQG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |