C10H16N2O4S2 — CID 120583848
methyl 4-(4-aminobutylsulfamoyl)thiophene-2-carboxylate (PubChem CID 120583848) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 4-(4-aminobutylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 4-(4-aminobutylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 120583848 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | methyl 4-(4-aminobutylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCCCN)cs1 |
| InChI | InChI=1S/C10H16N2O4S2/c1-16-10(13)9-6-8(7-17-9)18(14,15)12-5-3-2-4-11/h6-7,12H,2-5,11H2,1H3 |
| InChIKey | KUNDWSOWUSTEJW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|